1. #1
    ac4

    Grubu
    Yasaklı üye
    İş
    10. sınıf

    Sponsorlu Bağlantılar

    trigonometri

    1. soru ---> 2.sinxcosx=cos70 0,20 derece aralığında kaç kökü vardır ?
    2. soru ---> 0<x<90 aralığında cosx = 3/5 ise cot(45-x) nedir ?
    3. soru ---> a ve b 0 ile 90 aralığında sina=1/3 cosb=3/4 ise sin(a+b) = ?
    4. soru ---> x ve y 0 ile 90 aralığında cosx=1/4 cosy=1/3 ise cos(x-y) = ?
    5. soru ---> tan60.cos75+sin75 =?

  2. #2

    Statü
    Grubu
    Moderatör
    İş
    11. sınıf

    Sponsorlu Bağlantılar

    kusura bakılacak birşey yok kesin hüküm 5 soru diyoruz bi sorunuz silinmiştir.
    ayrıca konu başlıklarınızda "acil" vb.başlıklar bulundurmayın diye boşuna demiyoruz değil mi?
    1.
    sin2x=cos70
    sin2x=sin20
    2x=20 => x=10 bulunur.
    2.
    kotanjant açılımını kullanacaksınız.Hemen çıkacak.(öğretilmedi mi?)

    3.
    sin(a+b)=sinacosb+cosasinb olmalıdır.
    bunların hepsi verilmiş zaten artık yazıverin yerine.

    4
    cos(x-y)=cosxcosy+sinxsiny olduğunu biliyoruz artık burda da yazıverin yerine
    5.
    tan60ı 30-60-90 üçgeninden çekeceksini.
    cos75i falan da 15-75-90 üçgeninden çekebilirsiniz.

  3. #3
    ac4

    Grubu
    Yasaklı üye
    İş
    10. sınıf

    Sponsorlu Bağlantılar

    kusura bakılacak birşey yok kesin hüküm 5 soru diyoruz bi sorunuz silinmiştir.
    ayrıca konu başlıklarınızda "acil" vb.başlıklar bulundurmayın diye boşuna demiyoruz değil mi?
    1.
    sin2x=cos70
    sin2x=sin20
    2x=20 => x=10 bulunur.
    2.
    kotanjant açılımını kullanacaksınız.Hemen çıkacak.(öğretilmedi mi?)

    3.
    sin(a+b)=sinacosb+cosasinb olmalıdır.
    bunların hepsi verilmiş zaten artık yazıverin yerine.

    4
    cos(x-y)=cosxcosy+sinxsiny olduğunu biliyoruz artık burda da yazıverin yerine
    5.
    tan60ı 30-60-90 üçgeninden çekeceksini.
    cos75i falan da 15-75-90 üçgeninden çekebilirsiniz.
    Kardeş sen soru çözme ne olur. Başkası çözsün.

  4. #4

    Statü
    Grubu
    Moderatör
    İş
    11. sınıf
    çözümleri kısa kestim nedenini de söyliyeyim.
    6 soru sormuşsun , konu başlığını da konuya uygun seçmemişsin ben değiştirdim.
    forum kurallarını ihlal eden kimseye soru çözülmez bu forumda.
    açık değil mi? Daha netleşitirme me gerek yok!
    Dipnot:İlk yapmam gerekeni yarın sınavın var diye yapmamıştım şimdi yapmış bulunmaktayım konuya erişim kapatılmıştır.

  5. #5

    Statü
    Grubu
    Moderatör
    İş
    11. sınıf
    Özel Mesajla , Atatürk'e küfür ; Forumun Moderatörüne küfür suçundan forumdan uzaklaştırıldınız.
    Yarın ki sınavınızda kaç alacağınızı(!) seviyesizliğinizden anlamış durumdayız.


 

  • Bu yazıyı beğenerek
    destek
    verebilirsiniz

    Foruma üye olmana gerek yok! Facebook hesabınla yorumlarını bekliyoruz!
  • Forum Kullanım ve Gizlilik Kuralları