1. #1

    Statü
    Grubu
    Üye
    İş
    Diğer

    Sponsorlu Bağlantılar

    trigonometri

    1)sin254=a olduğuna göre sin²8 in a türünden değeri nedir ? (a-1/2 a²-1 a+1/2 a²+1

    2) 2tanx/2/1+tan²x/2 ? (cosx sinx tanx sinx/2 cosx/2)

    3)sin13=x olduğuna göre sin64 ün x türünden değeri ?

    4)cosx=2√3/3 olduğuan göre cos4x?

    5)sin12=k olduğuna göre
    sin282.tan168/cos348cos102 eşiti nedir ?

  2. #2

    Statü
    Grubu
    Kıdemli Üye
    İş
    Üniversite

    Sponsorlu Bağlantılar

    cevap şıklarını ekleme imkanınız var mı?

  3. #3

    Statü
    Grubu
    Üye
    İş
    Diğer

    Sponsorlu Bağlantılar

    3) a) 1-2x² b) 2x²-1 c) 2x²+1 d) x²+1 e) 2x²
    4)17/81 17/18 64/81 59/81 59/13
    5) -k 1/k -1/√1-k² k

  4. #4

    Statü
    Grubu
    Kıdemli Üye
    İş
    Üniversite
    Teşekkür ederim.
    4. soruda hipotenüs dik kenardan nasıl küçük olur ki ?
    açarak bulamadım, belki buradan devam ettirmek işinize yarar eğer denemediyseniz:



  5. #5

    Statü
    Grubu
    Kıdemli Üye
    İş
    Üniversite
    Cevap 2.

    x/2=a olsun. 2tana/(1+tan²a)=(2sina/cosa)/(1+(sina/cosa)²)
    =(2sina/cosa)/[(cos²a+sin²a)/(cosa)]
    =(2sina/cosa).(cosa.cosa/1)
    =(2sina.cosa)
    =sin2a
    =sin2.(x/2)
    =sinx


    Cevap 5.
    sin12=k

    sin282.tan168/cos348.cos102=
    sin(270+12).tan(180-12)/cos(360-12).cos(90+12)=
    (cos12).(-tan12)/(cos12).(sin12)=(-1/cos12)

    sin12=k ise, cos12=cos(90-78)=sin78 diyebiliriz, dik üçgenden -1/cos12=-1/(√(1-k²) olur.


    Cevap 1.
    sin254=sin(270-16)= -cos16=-(1-2in²8)=2sin²8-1=a, sin²8=(a+1)/2


 

  • Bu yazıyı beğenerek
    destek
    verebilirsiniz

    Foruma üye olmana gerek yok! Facebook hesabınla yorumlarını bekliyoruz!
  • Forum Kullanım ve Gizlilik Kuralları